6-(chloromethyl)-N-[4-(propan-2-yl)phenyl]-1,3,5-triazine-2,4-diamine
6-(chloromethyl)-2-N-(4-propan-2-ylphenyl)-1,3,5-triazine-2,4-diamine
Also Known As: KSC-16-16|6-(chloromethyl)-N-[4-(propan-2-yl)phenyl]-1,3,5-triazine-2,4-diamine|6-(chloromethyl)-N-(4-isopropylphenyl)-1,3,5-triazine-2,4-diamine|6-(chloromethyl)-2-N-(4-propan-2-ylphenyl)-1,3,5-triazine-2,4-diamine|[4-amino-6-(chloromethyl)(1,3,5-triazin-2-yl)][4-(methylethyl)phenyl]amine|6-(CHLOROMETHYL)-N2-(4-ISOPROPYLPHENYL)-1,3,5-TRIAZINE-2,4-DIAMINE|6-(CHLOROMETHYL)-N2-[4-(PROPAN-2-YL)PHENYL]-1,3,5-TRIAZINE-2,4-DIAMINE
| Molecular Formula | C13H16ClN5 |
|---|---|
| Molecular Weight | 277.10944 g/mol |
| LogP | 3.0596 |
| Topological Polar Surface Area | 76.72 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 277.10944 |
| Monoisotopic Mass | 277.10944 |
| Heavy Atoms | 19 |
| Complexity | 553.4601 |
Chemical Identifiers
| CAS Number | 577700-34-6 |
|---|---|
| SMILES | CC(C)C1=CC=C(C=C1)NC2=NC(=NC(=N2)N)CCl |
Product Overview
6-(chloromethyl)-N-[4-(propan-2-yl)phenyl]-1,3,5-triazine-2,4-diamine (CAS 577700-34-6), with molecular formula C13H16ClN5 and molecular weight 277.10944 g/mol. IUPAC: 6-(chloromethyl)-2-N-(4-propan-2-ylphenyl)-1,3,5-triazine-2,4-diamine.