AC1MH56D
N-[2-chloro-5-(trifluoromethyl)phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide
Also Known As: N-[2-chloro-5-(trifluoromethyl)phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide|AF-399/41981303|(1S,4S)-N-(2-chloro-5-(trifluoromethyl)phenyl)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide|N-[2-chloro-5-(trifluoromethyl)phenyl](4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2. 1]heptyl)carboxamide|N-[2-chloro-5-(trifluoromethyl)phenyl]-1,7,7-trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxamide
| Molecular Formula | C17H17ClF3NO3 |
|---|---|
| Molecular Weight | 375.0849 g/mol |
| LogP | 4.4192 |
| Topological Polar Surface Area | 55.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 375.0849 |
| Monoisotopic Mass | 375.0849 |
| Heavy Atoms | 25 |
| Complexity | 776.89185 |
Chemical Identifiers
| CAS Number | 577761-97-8 |
|---|---|
| SMILES | CC1(C2(CCC1(OC2=O)C(=O)NC3=C(C=CC(=C3)C(F)(F)F)Cl)C)C |
Product Overview
AC1MH56D (CAS 577761-97-8), with molecular formula C17H17ClF3NO3 and molecular weight 375.0849 g/mol. IUPAC: N-[2-chloro-5-(trifluoromethyl)phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide.