AC1MXJ9A
N-(4,4-dimethyl-15-methylsulfanyl-8-phenyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)-N',N'-dimethylethane-1,2-diamine
Also Known As: N'-[2,2-dimethyl-10-(methylsulfanyl)-5-phenyl-1,4-dihydro-2H-pyrano[4'',3'':4',5']pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-8-yl]-N,N-dimethylethane-1,2-diamine|N1-(2,2-dimethyl-10-(methylthio)-5-phenyl-2,4-dihydro-1H-pyrano[4'',3'':4',5']pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-8-yl)-N2,N2-dimethylethane-1,2-diamine
| Molecular Formula | C25H29N5OS2 |
|---|---|
| Molecular Weight | 479.18137 g/mol |
| LogP | 5.4532 |
| Topological Polar Surface Area | 63.17 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Exact Mass | 479.18137 |
| Monoisotopic Mass | 479.18137 |
| Heavy Atoms | 33 |
| Complexity | 1317.3743 |
Chemical Identifiers
| CAS Number | 577763-03-2 |
|---|---|
| SMILES | CC1(CC2=C(CO1)C(=NC3=C2C4=C(S3)C(=NC(=N4)SC)NCCN(C)C)C5=CC=CC=C5)C |
Product Overview
AC1MXJ9A (CAS 577763-03-2), with molecular formula C25H29N5OS2 and molecular weight 479.18137 g/mol. IUPAC: N-(4,4-dimethyl-15-methylsulfanyl-8-phenyl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)-N',N'-dimethylethane-1,2-diamine.