ATX inhibitor 10
(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one
Also Known As: ATX inhibitor 10|Disubstituted aryl-Me ATX inhibitor 3|Monosubstituted aryl-Me ATX inhibitor 5|(5Z)-5-(3,4-dichlorobenzylidene)-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4(5H)-one|(5Z)-5-[(3,4-dichlorophenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one|(Z)-5-(3,4-dichlorobenzylidene)-2-(4-methylpiperazin-1-yl)thiazol-4(5H)-one|5-[(3,4-dichlorophenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one|(5Z)-5-[(3,4-DICHLOROPHENYL)METHYLIDENE]-2-(4-METHYLPIPERAZIN-1-YL)-4,5-DIHYDRO-1,3-THIAZOL-4-ONE
| Molecular Formula | C15H15Cl2N3OS |
|---|---|
| Molecular Weight | 355.03128 g/mol |
| LogP | 3.2111 |
| Topological Polar Surface Area | 35.91 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 355.03128 |
| Monoisotopic Mass | 355.03128 |
| Heavy Atoms | 22 |
| Complexity | 666.75146 |
Chemical Identifiers
| CAS Number | 577765-38-9 |
|---|---|
| SMILES | CN1CCN(CC1)C2=NC(=O)/C(=C/C3=CC(=C(C=C3)Cl)Cl)/S2 |
Product Overview
ATX inhibitor 10 (CAS 577765-38-9), with molecular formula C15H15Cl2N3OS and molecular weight 355.03128 g/mol. IUPAC: (5Z)-5-[(3,4-dichlorophenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.