![N-{[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl}naphthalene-1-carboxamide structure](/static/products/577/577787-84-9.png)
N-{[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl}naphthalene-1-carboxamide
N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide
Also Known As: N-{[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl}naphthalene-1-carboxamide|N-((4-(4-methylpiperazin-1-yl)phenyl)carbamothioyl)-1-naphthamide|N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide|N-[[4-(4-methylpiperazin-1-yl)phenyl]thiocarbamoyl]naphthalene-1-carboxamide
| Molecular Formula | C23H24N4OS |
|---|---|
| Molecular Weight | 404.16708 g/mol |
| LogP | 3.7184 |
| Topological Polar Surface Area | 47.61 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 404.16708 |
| Monoisotopic Mass | 404.16708 |
| Heavy Atoms | 29 |
| Complexity | 1021.2371 |
Chemical Identifiers
| CAS Number | 577787-84-9 |
|---|---|
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC(=S)NC(=O)C3=CC=CC4=CC=CC=C43 |
Product Overview
N-{[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl}naphthalene-1-carboxamide (CAS 577787-84-9), with molecular formula C23H24N4OS and molecular weight 404.16708 g/mol. IUPAC: N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
N-{[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl}naphthalene-1-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »