1-(4-Chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone
1-(4-chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone
Also Known As: AK-918/42179455|1-(4-chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone|1-(4-chlorophenyl)-2-[4-(2-quinoxalinyl)phenoxy]ethanone|1-(4-chlorophenyl)-2-(4-(quinoxalin-2-yl)phenoxy)ethanone|1-(4-chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethan-1-one|1-(4-chlorophenyl)-2-[4-(quinoxalin-2-yl)phenoxy]ethanone|1-(4-CHLOROPHENYL)-2-[4-(QUINOXALIN-2-YL)PHENOXY]ETHAN-1-ONE
| Molecular Formula | C22H15ClN2O2 |
|---|---|
| Molecular Weight | 374.0822 g/mol |
| LogP | 5.2119 |
| Topological Polar Surface Area | 52.08 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 374.0822 |
| Monoisotopic Mass | 374.0822 |
| Heavy Atoms | 27 |
| Complexity | 1093.2816 |
Chemical Identifiers
| CAS Number | 577983-88-1 |
|---|---|
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C3=CC=C(C=C3)OCC(=O)C4=CC=C(C=C4)Cl |
Product Overview
1-(4-Chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone (CAS 577983-88-1), with molecular formula C22H15ClN2O2 and molecular weight 374.0822 g/mol. IUPAC: 1-(4-chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone.
1-(4-Chlorophenyl)-2-(4-quinoxalin-2-ylphenoxy)ethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »