AC1LZZ0C
5,6-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one
Also Known As: 5,6-dimethyl-2-[(4-methylbenzyl)sulfanyl]-3-(prop-2-en-1-yl)thieno[2,3-d]pyrimidin-4(3H)-one|3-allyl-5,6-dimethyl-2-((4-methylbenzyl)thio)thieno[2,3-d]pyrimidin-4(3H)-one|5,6-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one|5,6-dimethyl-2-[(4-methylphenyl)methylthio]-3-prop-2-enyl-3-hydrothiopheno[2,3 -d]pyrimidin-4-one|5,6-dimethyl-2-{[(4-methylphenyl)methyl]sulfanyl}-3-(prop-2-en-1-yl)-3H,4H-thieno[2,3-d]pyrimidin-4-one
| Molecular Formula | C19H20N2OS2 |
|---|---|
| Molecular Weight | 356.1017 g/mol |
| LogP | 4.86156 |
| Topological Polar Surface Area | 34.89 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 356.1017 |
| Monoisotopic Mass | 356.1017 |
| Heavy Atoms | 24 |
| Complexity | 952.14264 |
Chemical Identifiers
| CAS Number | 577989-23-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)CSC2=NC3=C(C(=C(S3)C)C)C(=O)N2CC=C |
Product Overview
AC1LZZ0C (CAS 577989-23-2), with molecular formula C19H20N2OS2 and molecular weight 356.1017 g/mol. IUPAC: 5,6-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.