4-methyl-N-[(E)-thiophen-2-ylmethylidene]piperazin-1-amine
(E)-N-(4-methylpiperazin-1-yl)-1-thiophen-2-ylmethanimine
Also Known As: CBMicro_033810|4-methyl-N-[(E)-thiophen-2-ylmethylidene]piperazin-1-amine|BIM-0033736.P001|(E)-N-(4-methylpiperazin-1-yl)-1-thiophen-2-ylmethanimine|2-[(4-Methylpiperazin-1-yl)iminomethyl]thiophene|2-[(1E)-2-(4-methylpiperazinyl)-2-azavinyl]thiophene|N-(4-methylpiperazin-1-yl)-1-thiophen-2-ylmethanimine|N-(4-methylpiperazin-1-yl)-1-(thiophen-2-yl)methanimine|(E)-N-(4-Methylpiperazin-1-yl)-1-(thiophen-2-yl)methanimine|N-(4-METHYLPIPERAZINO)-N-[(E)-1-(2-THIENYL)METHYLIDENE]AMINE
| Molecular Formula | C10H15N3S |
|---|---|
| Molecular Weight | 209.09866 g/mol |
| LogP | 1.3294 |
| Topological Polar Surface Area | 18.84 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 209.09866 |
| Monoisotopic Mass | 209.09866 |
| Heavy Atoms | 14 |
| Complexity | 286.32556 |
Chemical Identifiers
| CAS Number | 5789-33-3 |
|---|---|
| SMILES | CN1CCN(CC1)/N=C/C2=CC=CS2 |
Product Overview
4-methyl-N-[(E)-thiophen-2-ylmethylidene]piperazin-1-amine (CAS 5789-33-3), with molecular formula C10H15N3S and molecular weight 209.09866 g/mol. IUPAC: (E)-N-(4-methylpiperazin-1-yl)-1-thiophen-2-ylmethanimine.
4-methyl-N-[(E)-thiophen-2-ylmethylidene]piperazin-1-amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »