1-(1,1'-Biphenyl)-4-yl-4,4,4-trifluoro-1,3-butanedione
4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione
Also Known As: 1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione|1-([1,1'-Biphenyl]-4-yl)-4,4,4-trifluorobutane-1,3-dione|p-phenylbenzoyltrifluoroacetone|4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione|1-(4-Phenylbenzoyl)-3,3,3-trifluoroacetone|J1.415.795F|1-[1,1'-Biphenyl]-4-yl-4,4,4-trifluoro-1,3-butanedione|1-(1,1'-Biphenyl)-4-yl-4,4,4-trifluoro-1,3-butanedione|1-{[1,1'-BIPHENYL]-4-YL}-4,4,4-TRIFLUOROBUTANE-1,3-DIONE|860-200-6
| Molecular Formula | C16H11F3O2 |
|---|---|
| Molecular Weight | 292.0711 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 292.0711 |
| Monoisotopic Mass | 292.0711 |
| Heavy Atoms | 21 |
| Complexity | 375.0 |
Chemical Identifiers
| CAS Number | 581-83-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CC(=O)C(F)(F)F |
| InChIKey | ZLQXJKTXGNVKQB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-(1,1'-Biphenyl)-4-yl-4,4,4-trifluoro-1,3-butanedione (CAS 581-83-9), with molecular formula C16H11F3O2 and molecular weight 292.0711 g/mol. IUPAC: 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione.