2-Methylpropyl 4-chloro-3,5-dinitrobenzoate
2-methylpropyl 4-chloro-3,5-dinitrobenzoate
Also Known As: 2-methylpropyl 4-chloro-3,5-dinitrobenzoate|Isobutyl 4-chloro-3,5-dinitrobenzoate|Isobutyl 3,5-dinitro-4-chlorobenzoate|isobutyl-3,5-dinitro-4-chlorobenzoate|Isobutyl4-chloro-3,5-dinitrobenzoate|4-Chloro-3,5-dinitro-benzoic acid isobutyl ester|isobutyl 4-chloro-3,5-dinitro-benzoate|4-Chloro-3,5-dinitrobenzoic acid isobutyl ester|M-1268|Benzoic acid,4-chloro-3,5-dinitro-isobutyl ester|I01-3720|SR-01000078319-1|4-CHLORO-3,5-DINITRO-BENZOICACIDISOBUTYLESTER|Benzoic acid, 4-chloro-3,5-dinitro-, 2-methylpropyl ester|Benzoic acid,4-chloro-3,5-dinitro-, 2-methylpropyl ester
| Molecular Formula | C11H11ClN2O6 |
|---|---|
| Molecular Weight | 302.03058 g/mol |
| LogP | 2.9692 |
| Topological Polar Surface Area | 112.58 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 302.03058 |
| Monoisotopic Mass | 302.03058 |
| Heavy Atoms | 20 |
| Complexity | 537.0269 |
Chemical Identifiers
| CAS Number | 58263-53-9 |
|---|---|
| SMILES | CC(C)COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)[N+](=O)[O-] |
Product Overview
2-Methylpropyl 4-chloro-3,5-dinitrobenzoate (CAS 58263-53-9), with molecular formula C11H11ClN2O6 and molecular weight 302.03058 g/mol. IUPAC: 2-methylpropyl 4-chloro-3,5-dinitrobenzoate.