4-Bromo-4'-methoxybiphenyl
1-bromo-4-(4-methoxyphenyl)benzene
Also Known As: 4-Bromo-4'-methoxybiphenyl|1-bromo-4-(4-methoxyphenyl)benzene|4-Bromo-4'-methoxy-1,1'-biphenyl|PentamethoxyRed|4-(4-Bromophenyl)anisole|ACMC-209m6x|4-bromo-4'-metoxybiphenyl|AMTDA038|4-(4'-bromophenyl)anisole|4-methoxy-4'-bromobiphenyl|4'-bromo-4-methoxy-biphenyl|4-(4'-bromophenyl)-anisole|4 -Bromo-4-methoxybiphenyl|4 -Methoxy-4-bromobiphenyl|4-Bromo-4 -methoxybiphenyl|4-Methoxy-4 -bromobiphenyl|1-(4-bromophenyl)-4-methoxybenzene|4-Bromo-4'-methoxybiphenyl, 95%|4'-bromobiphenyl-4-yl methyl ether|AS-2078|1,1'-Biphenyl, 4-bromo-4'-methoxy-|KS-0000196B|4-Bromo-4 -methoxy-1,1 -biphenyl
| Molecular Formula | C13H11BrO |
|---|---|
| Molecular Weight | 261.99933 g/mol |
| LogP | 4.1247 |
| Topological Polar Surface Area | 9.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 261.99933 |
| Monoisotopic Mass | 261.99933 |
| Heavy Atoms | 15 |
| Complexity | 431.09805 |
Chemical Identifiers
| CAS Number | 58743-83-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Product Overview
4-Bromo-4'-methoxybiphenyl (CAS 58743-83-2), with molecular formula C13H11BrO and molecular weight 261.99933 g/mol. IUPAC: 1-bromo-4-(4-methoxyphenyl)benzene.