Benzenamine, N-[(2-chlorophenyl)methylene]-
1-(2-chlorophenyl)-N-phenylmethanimine
Also Known As: ACMC-20haiv|Boron fluoride,diphenylate|N-(2-Chlorobenzylidene)aniline|N-(o-chlorobenzylidene)aniline|N-Phenyl-2-chlorobenzylideneamine|2-Chloro-N-phenylbenzenemethanimine|N-Phenyl-2-chlorobenzenemethanimine|1-(2-chlorophenyl)-N-phenylmethanimine|(E)-N-(2-Chlorobenzylidene)aniline|Benzenamine, N-[(2-chlorophenyl)methylene]-|Benzenamine, N-[(chlorophenyl)methylene]-|N-[(2-chlorophenyl)methylene]benzamine|(E)-N-Phenyl-2-chlorobenzenemethaneimine|Benzenamine, N-[(2-chlorophenyl)methylene]|(E)-1-(2-chlorophenyl)-N-phenylmethanimine|J1.025.899E|J2.628.196B
| Molecular Formula | C13H10ClN |
|---|---|
| Molecular Weight | 215.05017 g/mol |
| LogP | 4.1 |
| Topological Polar Surface Area | 12.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 215.05017 |
| Monoisotopic Mass | 215.05017 |
| Heavy Atoms | 15 |
| Complexity | 209.0 |
Chemical Identifiers
| CAS Number | 5877-49-6 |
|---|---|
| SMILES | C1=CC=C(C=C1)N=CC2=CC=CC=C2Cl |
| InChIKey | BIXVUZSUHIDQQJ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzenamine, N-[(2-chlorophenyl)methylene]- (CAS 5877-49-6), with molecular formula C13H10ClN and molecular weight 215.05017 g/mol. IUPAC: 1-(2-chlorophenyl)-N-phenylmethanimine.