Ethyl 4-nitro-3-phenyl-L-alaninate monohydrochloride
ethyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride
Also Known As: H-Phe(4-NO2)-OEt.HCl|h-4-nitro-phe-oet hcl|h-phe(4-no2)-oet hcl|Ac-D-Lys-OH|H-4-Nitro-Phe-OEt . HCl|4-NO2-Phe-Oet.HCl|Ethyl 4-nitro-3-phenyl-L-alaninate monohydrochloride|3-(4-nitrophenyl)-L-alanine ethyl ester hydrochloride|EINECS 261-455-0|H-4-NITRO-PHE-OETHCL|3-(4-nitro-phenyl)-L-alanine ethyl ester hydrochloride|Ethyl 4-nitro-3-phenyl-L-alaninate HCl|H-4-Nitro-phe-oet hydrochloride|KS-00000GCH|CS-M0206|3-(4-nitro-phenyl)-l-alanine ethyl ester hcl|4-nitro-l-phenylalanine ethyl ester hydrochloride|H-PHE(4-NO2)-OET HYDROCHLORIDE|ethyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride|4-nitrophenylalanine ethyl ester hydrochloride|S-2127|4-nitrophenylalanine, ethyl ester, hydrochloride
| Molecular Formula | C11H15ClN2O4 |
|---|---|
| Molecular Weight | 274.07202 g/mol |
| LogP | 1.4495 |
| Topological Polar Surface Area | 95.46 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 274.07202 |
| Monoisotopic Mass | 274.07202 |
| Heavy Atoms | 18 |
| Complexity | 408.00916 |
Chemical Identifiers
| CAS Number | 58840-79-2 |
|---|---|
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Product Overview
Ethyl 4-nitro-3-phenyl-L-alaninate monohydrochloride (CAS 58840-79-2), with molecular formula C11H15ClN2O4 and molecular weight 274.07202 g/mol. IUPAC: ethyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride.