Z-Glu-OtBu
(4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid
Also Known As: z-glu-otbu|Z-D-norvaline|Cbz-Glu-OtBu|Cbz-L-Glu-Otbu|Z-L-Glu-OtBu|Linaclotide Impurity 27|Z-D-NVA-OH|1-tert-Butyl N-Cbz-L-glutamate|Z-Glu-OtBu - 5G 5g|KS-00000KNJ|Z-L-glutamic acid alpha-tert-butyl ester|(S)-4-(((Benzyloxy)carbonyl)amino)-5-(tert-butoxy)-5-oxopentanoic acid|KM0256|AC-7894|CS-W008549|HY-W008549|Z-L-glutamic acid |A-tert.butyl ester|Cbz-L-glutamic acid 1-tert-butyl ester|1-tert-Butyl N-Carbobenzoxy-L-glutamate|N-Cbz-L-glutamic Acid 1-tert-Butyl Ester|J1.504.590F
| Molecular Formula | C17H23NO6 |
|---|---|
| Molecular Weight | 337.15253 g/mol |
| LogP | 2.4879 |
| Topological Polar Surface Area | 101.93 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 337.15253 |
| Monoisotopic Mass | 337.15253 |
| Heavy Atoms | 24 |
| Complexity | 564.19354 |
Chemical Identifiers
| CAS Number | 5891-45-2 |
|---|---|
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Product Overview
Z-Glu-OtBu (CAS 5891-45-2), with molecular formula C17H23NO6 and molecular weight 337.15253 g/mol. IUPAC: (4S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid.