![1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene structure](/static/products/590/59019-40-8.png)
1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene
1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene
Also Known As: 1-(2-bromo-2-nitrovinyl)-4-methoxybenzene|1-Bromo-1-nitro-2-(4-methoxyphenyl)ethene|1-(2-bromo-2-nitroethenyl)-4-methoxybenzene|1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene|1-methoxy-4-(2-bromo-2-nitroethenyl)benzene|4-Methoxy-1-(2-bromo-2-nitroethenyl)benzene|J2.532.106E|AB00080595-01|(Z)-1-Bromo-1-nitro-2-(4-methoxyphenyl)ethene|1-[(1Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene
| Molecular Formula | C9H8BrNO3 |
|---|---|
| Molecular Weight | 256.96875 g/mol |
| LogP | 2.6652 |
| Topological Polar Surface Area | 52.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 256.96875 |
| Monoisotopic Mass | 256.96875 |
| Heavy Atoms | 14 |
| Complexity | 358.82474 |
Chemical Identifiers
| CAS Number | 59019-40-8 |
|---|---|
| SMILES | COC1=CC=C(C=C1)/C=C(/[N+](=O)[O-])\Br |
Product Overview
1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene (CAS 59019-40-8), with molecular formula C9H8BrNO3 and molecular weight 256.96875 g/mol. IUPAC: 1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene.
1-[(Z)-2-bromo-2-nitroethenyl]-4-methoxybenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »