Phosphonothioic acid, methyl-, O-methyl O-(p-(methylsulfonyl)phenyl) ester
methoxy-methyl-(4-methylsulfonylphenoxy)-sulfanylidene-λ5-phosphane
Also Known As: Bayer 30554|ENT 25,615|Phosphonothioic acid, methyl-, O-methyl O-(p-(methylsulfonyl)phenyl) ester|Phosphonothioic acid, methyl-, O-methyl O-(4-(methylsulfonyl)phenyl) ester|methoxy-methyl-(4-methylsulfonylphenoxy)-sulfanylidene-|O-[4-(Methanesulfonyl)phenyl] O-methyl methylphosphonothioate|Phosphonothioic acid, methyl-, O-methyl O-[4-(methylsulfonyl)phenyl] ester|Phosphonothioic acid, methyl-, O-methyl O-[p-(methylsulfonyl)phenyl] ester|Phosphonothioic acid, methyl-, O-methyl O-(4-(methylsulfonyl)phenyl) ester (9CI)
| Molecular Formula | C9H13O4PS2 |
|---|---|
| Molecular Weight | 279.9993 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 93.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 279.9993 |
| Monoisotopic Mass | 279.9993 |
| Heavy Atoms | 16 |
| Complexity | 365.0 |
Chemical Identifiers
| CAS Number | 5902-78-3 |
|---|---|
| SMILES | COP(=S)(C)OC1=CC=C(C=C1)S(=O)(=O)C |
| InChIKey | WCASBNKBTQYJSW-UHFFFAOYSA-N |
Product Overview
Phosphonothioic acid, methyl-, O-methyl O-(p-(methylsulfonyl)phenyl) ester (CAS 5902-78-3), with molecular formula C9H13O4PS2 and molecular weight 279.9993 g/mol. IUPAC: methoxy-methyl-(4-methylsulfonylphenoxy)-sulfanylidene-λ5-phosphane.