Triethanolamine methanearsonate
2-[bis(2-hydroxyethyl)amino]ethanol;methylarsonic acid
Also Known As: Triethanolamine methanearsonate|Caswell No. 887B|Ansar-290 D|ANSAR 290-D|ANTINEOPLASTIC-71156|EPA Pesticide Chemical Code 013807|Methanearsonic acid, triethanolamine salt|Methanearsonic acid, compd. with 2,2',2''-nitrilotriethanol|Ethanol, 2,2',2''-nitrilotri-, compd. with methanearsonic acid|2-[bis(2-hydroxyethyl)amino]ethanol; methylarsonic acid|ETHANOL, 2,2',2''-NITRILOTRI-, METHANEARSONATE|ETHANOL, 2,2',2''-NITRILOTRIS-, METHYLARSONATE (SALT)|Methylarsonic acid - 2,2',2''-nitrilotriethanol (1:1)|Arsonic acid, methyl-, compd. with 2,2,2-nitrilotris[ethanol]|Methylarsonic acid--2,2',2''-nitrilotri(ethan-1-ol) (1/1)|Arsonic acid, methyl-, compd. with 2,2',2''-nitrilotris(ethanol)|Arsonic acid, methyl-, compd. with 2,2',2''-nitrilotris[ethanol]
| Molecular Formula | C7H20AsNO6 |
|---|---|
| Molecular Weight | 289.05066 g/mol |
| LogP | -2.7645 |
| Topological Polar Surface Area | 121.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Exact Mass | 289.05066 |
| Monoisotopic Mass | 289.05066 |
| Heavy Atoms | 15 |
| Complexity | 117.0 |
Chemical Identifiers
| CAS Number | 5902-97-6 |
|---|---|
| SMILES | C[As](=O)(O)O.C(CO)N(CCO)CCO |
| InChIKey | KLSDNCJATZZDJY-UHFFFAOYSA-N |
Product Overview
Triethanolamine methanearsonate (CAS 5902-97-6), with molecular formula C7H20AsNO6 and molecular weight 289.05066 g/mol. IUPAC: 2-[bis(2-hydroxyethyl)amino]ethanol;methylarsonic acid.