4-Chloro-2-isopropyl-5-methylanisole
1-chloro-4-methoxy-2-methyl-5-propan-2-ylbenzene
Also Known As: Methyl chlorothymol|4-Chloro-2-isopropyl-5-methylanisole|4-chloro-2-isopropyl-5-methyl-anisole|1-Chloro-5-isopropyl-4-methoxy-2-methylbenzene|1-chloro-4-methoxy-2-methyl-5-propan-2-yl-benzene|1-chloro-4-methoxy-2-methyl-5-propan-2-ylbenzene|2-chloro-5-methoxy-1-methyl-4-(methylethyl)benzene|1-chloro-4-methoxy-2-methyl-5-(1-methylethyl)benzene|1-Chloro-4-methoxy-2-methyl-5-(propan-2-yl)benzene|666-266-0
| Molecular Formula | C11H15ClO |
|---|---|
| Molecular Weight | 198.08115 g/mol |
| LogP | 3.78042 |
| Topological Polar Surface Area | 9.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 198.08115 |
| Monoisotopic Mass | 198.08115 |
| Heavy Atoms | 13 |
| Complexity | 305.20374 |
Chemical Identifiers
| CAS Number | 5903-07-1 |
|---|---|
| SMILES | CC1=CC(=C(C=C1Cl)C(C)C)OC |
Product Overview
4-Chloro-2-isopropyl-5-methylanisole (CAS 5903-07-1), with molecular formula C11H15ClO and molecular weight 198.08115 g/mol. IUPAC: 1-chloro-4-methoxy-2-methyl-5-propan-2-ylbenzene.
4-Chloro-2-isopropyl-5-methylanisole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »