N-[(E)-2-thienylmethylidene]aniline
N-phenyl-1-thiophen-2-ylmethanimine
Also Known As: N-(2-thienylmethylene)aniline|N-[(E)-2-thienylmethylidene]aniline|N-(2-Thenylidene)aniline|2-(Phenyliminomethyl)thiophene|N-phenyl-1-thiophen-2-ylmethanimine|N-(thiophen-2-ylmethylene)aniline|N-Phenyl(2-thienyl)methanimine|N-Phenylthiophene-2-methanimine|N-Phenyl-2-thiophenemethaneimine|N-(2-thienylmethylidene)-aniline|N-[(2-Thienyl)methylene]aniline|N-(2-Thienylmethylene)benzenamine|(1E)-N-phenyl-1-(thiophen-2-yl)methanimine|N-phenyl-1-(thiophen-2-yl)methanimine|KS-0000386B|4P-017|N-(4-bromophenyl)-3-(4-chlorophenyl)sulfonyl-2,,5-dimethyl benzenesulfonamide
| Molecular Formula | C11H9NS |
|---|---|
| Molecular Weight | 187.04558 g/mol |
| LogP | 3.4987 |
| Topological Polar Surface Area | 12.36 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 187.04558 |
| Monoisotopic Mass | 187.04558 |
| Heavy Atoms | 13 |
| Complexity | 375.73724 |
Chemical Identifiers
| CAS Number | 5918-68-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)N=CC2=CC=CS2 |
Product Overview
N-[(E)-2-thienylmethylidene]aniline (CAS 5918-68-3), with molecular formula C11H9NS and molecular weight 187.04558 g/mol. IUPAC: N-phenyl-1-thiophen-2-ylmethanimine.
N-[(E)-2-thienylmethylidene]aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »