AC1MECW2
N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide
Also Known As: CBMicro_037179|CCG-3553|N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazin-2-yl]acetamide|BAS 03571507|BIM-0037146.P001|F1065-0506|AF-399/13082015|SR-01000467323-1|N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide|N-(2-cyanophenyl)-2-(3-oxo-6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]thiazin-2-yl)acetamide|N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)(2H,4H-benzo[e]1,4-thiazaperhydr oin-2-yl)]acetamide
| Molecular Formula | C18H12F3N3O2S |
|---|---|
| Molecular Weight | 391.06024 g/mol |
| LogP | 4.01868 |
| Topological Polar Surface Area | 81.99 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 391.06024 |
| Monoisotopic Mass | 391.06024 |
| Heavy Atoms | 27 |
| Complexity | 953.5985 |
Chemical Identifiers
| CAS Number | 5920-72-9 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C#N)NC(=O)CC2C(=O)NC3=C(S2)C=CC(=C3)C(F)(F)F |
Product Overview
AC1MECW2 (CAS 5920-72-9), with molecular formula C18H12F3N3O2S and molecular weight 391.06024 g/mol. IUPAC: N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide.