2,4-Bis(bromomethyl)estrone methyl ether
(8R,9S,13S,14S)-2,4-bis(bromomethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
Also Known As: 2,4-Bis(bromomethyl)estrone methyl ether|Sid 768770|2,4-Bis(bromomethyl)-3-methoxy-1,3,5(10)-estratrien-17-one|(8R,9S,13S,14S)-2,4-bis(bromomethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one|19-bromo-2-(bromomethyl)-1-methoxy-4,9-cyclo-9,10-secoandrosta-1(10),2,4-trien-17-one|19-Bromo-2-(bromomethyl)-1-methoxy-8beta,9alpha-4,9-cyclo-9,10-secoandrosta-1(10),2,4-trien-17-one
| Molecular Formula | C21H26Br2O2 |
|---|---|
| Molecular Weight | 468.02997 g/mol |
| LogP | 4.6 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 468.02997 |
| Monoisotopic Mass | 468.02997 |
| Heavy Atoms | 25 |
| Complexity | 524.0 |
Chemical Identifiers
| CAS Number | 5955-89-5 |
|---|---|
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=C(C(=C4CBr)OC)CBr |
| InChIKey | MIRBCRXKIBUCFR-POXQLVPFSA-N |
Product Overview
2,4-Bis(bromomethyl)estrone methyl ether (CAS 5955-89-5), with molecular formula C21H26Br2O2 and molecular weight 468.02997 g/mol. IUPAC: (8R,9S,13S,14S)-2,4-bis(bromomethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
2,4-Bis(bromomethyl)estrone methyl ether is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »