Methyl trityl ether
[methoxy(diphenyl)methyl]benzene
Also Known As: Methyl trityl ether|Methyl triphenylmethyl ether|Trityl methyl ether|(Methoxymethanetriyl)tribenzene|Ether, methyl trityl|methoxytriphenylmethane|[Methoxy(diphenyl)methyl]benzene|Triphenylmethyl methyl ether|methyltrityl ether|(methoxydiphenylmethyl)benzene|Fimasartan Impurity M|Zidovudine Impurity 15|TRIPHENYLMETHOXYMETHANE|Methyl(triphenylmethyl) ether|Triphenylcarbinol methyl ether|Triphenylmethanol methyl ether|Triphenylmethanol, methyl ether|Benzene, 1,1',1''-(methoxymethylidyne)tris-|1,1',1"-(Methoxymethylidyne)trisbenzene|FR-1039|ZIDOVUDINE IMPURITY K [EP IMPURITY]|Triphenylmethyl-containing compound, 14|Candesartan Trityl Methyl Ether Impurity
| Molecular Formula | C20H18O |
|---|---|
| Molecular Weight | 274.13577 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 9.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 274.13577 |
| Monoisotopic Mass | 274.13577 |
| Heavy Atoms | 21 |
| Complexity | 247.0 |
Chemical Identifiers
| CAS Number | 596-31-6 |
|---|---|
| SMILES | COC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChIKey | IRMNIXXVOOMKKP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 16 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl trityl ether (CAS 596-31-6), with molecular formula C20H18O and molecular weight 274.13577 g/mol. IUPAC: [methoxy(diphenyl)methyl]benzene.