Lepidiline B
1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium chloride
Also Known As: LEPIDILINE B|Macaline B|1,3-dibenzyl-2,4,5-trimethylimidazolium chloride|1,3-dibenzyl-2,4,5-trimethyl-1H-imidazol-3-ium chloride|1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium;chloride|1,3-dibenzyl-2,4,5-trimethyl-imidazole Chloride|1H-Imidazolium, 2,4,5-trimethyl-1,3-bis(phenylmethyl)-, chloride (1:1)|1,3-dibenzyl-2,4,5-trimethyl-1,2-dihydroimidazol-1-ium,chloride|1H-Imidazolium,2,4,5-trimethyl-1,3-bis(phenylmethyl)-,chloride
| Molecular Formula | C20H23ClN2 |
|---|---|
| Molecular Weight | 326.15497 g/mol |
| LogP | 0.80146 |
| Topological Polar Surface Area | 8.81 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 4 |
| Exact Mass | 326.15497 |
| Monoisotopic Mass | 326.15497 |
| Heavy Atoms | 23 |
| Complexity | 696.3407 |
Chemical Identifiers
| CAS Number | 596093-97-9 |
|---|---|
| SMILES | CC1=C([N+](=C(N1CC2=CC=CC=C2)C)CC3=CC=CC=C3)C.[Cl-] |
Product Overview
Lepidiline B (CAS 596093-97-9), with molecular formula C20H23ClN2 and molecular weight 326.15497 g/mol. IUPAC: 1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium chloride.
Lepidiline B is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »