1-(2-(2-Chlorophenyl)-3-(4-chlorophenyl)propyl)-1H-imidazole
1-[2-(2-chlorophenyl)-3-(4-chlorophenyl)propyl]imidazole
Also Known As: 1-(2-(2-Chlorophenyl)-3-(4-chlorophenyl)propyl)-1H-imidazole|1-[2-(2-chlorophenyl)-3-(4-chlorophenyl)propyl]imidazole|1-[2-(2-Chlorophenyl)-3-(4-chlorophenyl)propyl]-1H-imidazole|1-[2-(2-chloro-phenyl)-3-(4-chloro-phenyl)-propyl]-1H-imidazole|1H-Imidazole, 1-[2-(2-chlorophenyl)-3-(4-chlorophenyl)propyl]-
| Molecular Formula | C18H16Cl2N2 |
|---|---|
| Molecular Weight | 330.06906 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 17.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Exact Mass | 330.06906 |
| Monoisotopic Mass | 330.06906 |
| Heavy Atoms | 22 |
| Complexity | 331.0 |
Chemical Identifiers
| CAS Number | 59666-49-8 |
|---|---|
| SMILES | C1=CC=C(C(=C1)C(CC2=CC=C(C=C2)Cl)CN3C=CN=C3)Cl |
| InChIKey | BWJJILLEXQJLOI-UHFFFAOYSA-N |
Product Overview
1-(2-(2-Chlorophenyl)-3-(4-chlorophenyl)propyl)-1H-imidazole (CAS 59666-49-8), with molecular formula C18H16Cl2N2 and molecular weight 330.06906 g/mol. IUPAC: 1-[2-(2-chlorophenyl)-3-(4-chlorophenyl)propyl]imidazole.
1-(2-(2-Chlorophenyl)-3-(4-chlorophenyl)propyl)-1H-imidazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »