Phenol, 2,6-bis(1,1-dimethylethyl)-4-[(2,4,6-trimethylphenyl)methyl]-
2,6-ditert-butyl-4-[(2,4,6-trimethylphenyl)methyl]phenol
Also Known As: 2,6-Ditert-butyl-4-(mesitylmethyl)phenol|2,6-Di(tert-butyl)-4-(2,4,6-trimethylbenzyl)phenol|2,6-Ditert-butyl-4-(mesitylmethyl)phenol #|3',5'-Di-tert.-butyl-4'-hydroxybenzylmesitylen|2,6-di-t-butyl-4-(2,4,6-trimethylbenzyl)phenol|2,6-ditert-butyl-4-[(2,4,6-trimethylphenyl)methyl]phenol|2,6-Di-tert-butyl-4-(2,4,6-trimethylbenzyl)phenol|Phenol, 2,6-bis(1,1-dimethylethyl)-4-[(2,4,6-trimethylphenyl)methyl]-|2,6-DI-TERT-BUTYL-4-[(2,4,6-TRIMETHYLPHENYL)METHYL]PHENOL
| Molecular Formula | C24H34O |
|---|---|
| Molecular Weight | 338.26096 g/mol |
| LogP | 7.9 |
| Topological Polar Surface Area | 20.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 338.26096 |
| Monoisotopic Mass | 338.26096 |
| Heavy Atoms | 25 |
| Complexity | 390.0 |
Chemical Identifiers
| CAS Number | 59778-96-0 |
|---|---|
| SMILES | CC1=CC(=C(C(=C1)C)CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)C |
| InChIKey | OHUWUMGGWMNUEP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 10 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phenol, 2,6-bis(1,1-dimethylethyl)-4-[(2,4,6-trimethylphenyl)methyl]- (CAS 59778-96-0), with molecular formula C24H34O and molecular weight 338.26096 g/mol. IUPAC: 2,6-ditert-butyl-4-[(2,4,6-trimethylphenyl)methyl]phenol.