p-Bromoacetophenone oxime, (E)-
(NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine
Also Known As: p-Bromoacetophenone oxime|1-(4-Bromophenyl)ethanone oxime|4'-Bromoacetophenone oxime|p-Bromoacetophenone oxime, (E)-|Methyl 4-bromophenyl ketoxime|p-Bromoacetophenone oxime [MI]|(E)-p-bromoacetophenone oxime|4 -Bromoacetophenone oxime|Acetophenone, 4'-bromo-, oxime|p-Bromophenyl methyl ketone oxime|1-(4-bromophenyl)ethanoneoxime|4 -Bromoacetophenone (E)-oxime|Ethanone, 1-(4-bromophenyl)-, oxime, (E)-|1-(4-Bromophenyl)acetaldehyde oxime|Methyl (4-bromophenyl) ketone oxime|1-(4-Bromophenyl)ethan-1-one oxime|Ethanone, 1-(4-bromophenyl)-, oxime, (1E)-|Ethanone, 1-(4-bromophenyl)-, oxime|P-BROMOACETOPHENONE OXIME E-FORM|P-BROMOACETOPHENONE OXIME E-FORM [MI]|(E)-1-(4-bromophenyl)ethan-1-one oxime|(1E)-1-(4-bromophenyl)-N-hydroxyethanimine|J2.588.565A|N-[1-(4-bromophenyl)ethylidene]hydroxylamine|(NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine|(E)-N-[1-(4-BROMOPHENYL)ETHYLIDENE]HYDROXYLAMINE
| Molecular Formula | C8H8BrNO |
|---|---|
| Molecular Weight | 212.97893 g/mol |
| LogP | 2.6473 |
| Topological Polar Surface Area | 32.59 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 212.97893 |
| Monoisotopic Mass | 212.97893 |
| Heavy Atoms | 11 |
| Complexity | 265.92548 |
Chemical Identifiers
| CAS Number | 59862-55-4 |
|---|---|
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)Br |
Product Overview
p-Bromoacetophenone oxime, (E)- (CAS 59862-55-4), with molecular formula C8H8BrNO and molecular weight 212.97893 g/mol. IUPAC: (NE)-N-[1-(4-bromophenyl)ethylidene]hydroxylamine.