Methyl 5-tert-butylfuran-2-carboxylate
methyl 5-tert-butylfuran-2-carboxylate
Also Known As: methyl 5-tert-butyl-2-furoate|methyl 5-tert-butylfuran-2-carboxylate|methyl 5-(tert-butyl)furan-2-carboxylate|NCIOpen2_000609|RW2724|me-thyl 5-t-butylfuran-2-carboxylate|methyl5-(tert-butyl)furan-2-carboxylate|methyl 5-tert.-butyl-furan-2-carboxylate|5-tert-butyl-furan-2-carboxylic acid methyl ester|2-Furancarboxylic acid,5-(1,1-dimethylethyl)-, methyl ester|2-furancarboxylic acid, 5-(1,1-dimethylethyl)-, methyl ester|2-Furancarboxylic acid,5-(1,1-dimethylethyl)-,methyl ester
| Molecular Formula | C10H14O3 |
|---|---|
| Molecular Weight | 182.0943 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 39.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 182.0943 |
| Monoisotopic Mass | 182.0943 |
| Heavy Atoms | 13 |
| Complexity | 193.0 |
Chemical Identifiers
| CAS Number | 59907-23-2 |
|---|---|
| SMILES | CC(C)(C)C1=CC=C(O1)C(=O)OC |
| InChIKey | UBRPDRSWIRZWQG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 5-tert-butylfuran-2-carboxylate (CAS 59907-23-2), with molecular formula C10H14O3 and molecular weight 182.0943 g/mol. IUPAC: methyl 5-tert-butylfuran-2-carboxylate.