Tetraphosphetane, tetrabutyl-
1,2,3,4-tetratert-butyltetraphosphetane
Also Known As: Tetraphosphetane, tetrabutyl-|Tetraphosphetane,tetrabutyl-|tetra-tert-butyltetraphosphetane|1,2,3,4-tetratert-butyltetraphosphetane|Cyclobutaphosphane, tetrakis(1,1-dimethylethyl)-|J1.354.040C|J2.465.843K|Tetraphosphetane, tetrakis(1,1-dimethylethyl)-|(1r,2r,3r,4r)-tetra-tert-butyltetraphosphetane|Tetra-tert-butyl-1,2,3,4-tetraphosphacyclobutane|1,2,3,4-Tetra-tert-butyl-1,2,3,4-tetraphosphacyclobutane|1alpha,2beta,3alpha,4beta-Tetra-tert-butyl-1,2,3,4-tetraphosphacyclobutane
| Molecular Formula | C16H36P4 |
|---|---|
| Molecular Weight | 352.17676 g/mol |
| LogP | 3.5 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 4 |
| Exact Mass | 352.17676 |
| Monoisotopic Mass | 352.17676 |
| Heavy Atoms | 20 |
| Complexity | 269.0 |
Chemical Identifiers
| CAS Number | 5995-07-3 |
|---|---|
| SMILES | CC(C)(C)P1P(P(P1C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChIKey | CHHDFVOSNVZRCL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Tetraphosphetane, tetrabutyl- (CAS 5995-07-3), with molecular formula C16H36P4 and molecular weight 352.17676 g/mol. IUPAC: 1,2,3,4-tetratert-butyltetraphosphetane.