2-(Dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;sulfuric acid
2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;sulfuric acid
Also Known As: (C8-H15-N-O2.C3-H5-N-O.1/2H2-O4-S)x-|Acrylamide, dimethylaminoethyl methacrylate, sulfuric acid salt polymer|2-dimethylaminoethyl 2-methylprop-2-enoate; prop-2-enamide; sulfuric acid|2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, sulfate (2:1), polymer with 2-propenamide
| Molecular Formula | C11H22N2O7S |
|---|---|
| Molecular Weight | 326.11478 g/mol |
| LogP | -0.3278 |
| Topological Polar Surface Area | 156.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Exact Mass | 326.11478 |
| Monoisotopic Mass | 326.11478 |
| Heavy Atoms | 21 |
| Complexity | 291.0 |
Chemical Identifiers
| CAS Number | 60162-07-4 |
|---|---|
| SMILES | CC(=C)C(=O)OCCN(C)C.C=CC(=O)N.OS(=O)(=O)O |
| InChIKey | SJWSQHLEWJACHG-UHFFFAOYSA-N |
Product Overview
2-(Dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;sulfuric acid (CAS 60162-07-4), with molecular formula C11H22N2O7S and molecular weight 326.11478 g/mol. IUPAC: 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;sulfuric acid.
2-(Dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;sulfuric acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »