1-(4-Methylphenyl)-3-(2-thienyl)-2-propen-1-one
1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one
Also Known As: KS-00001MG4|4'-Methyl-3-(2-thienyl)acrylophenone|1-(4-methylphenyl)-3-(2-thienyl)prop-2-en-1-one|3-(Thiophen-2-yl)-1-(p-tolyl)prop-2-en-1-one|1-(4-Methylphenyl)-3-(2-thienyl)-2-propen-1-one|1-(p-tolyl)-3-(2-thienyl)prop-2-en-1-one|(2E)-1-(4-methylphenyl)-3-(thiophen-2-yl)prop-2-en-1-one|3-(2-THIENYL)-1-(P-TOLYL)-PROP-2-EN-1-ONE|1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one|1-(4-methylphenyl)-3-(thiophen-2-yl)prop-2-en-1-one|1-(4-METHYLPHENYL)-3-(THIEN-2-YL)PROP-2-EN-1-ONE|3-(2-THIENYL)-1-(P-TOLYL)-2-PROPEN-1-ONE, 98%
| Molecular Formula | C14H12OS |
|---|---|
| Molecular Weight | 228.06088 g/mol |
| LogP | 3.8 |
| Topological Polar Surface Area | 45.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 228.06088 |
| Monoisotopic Mass | 228.06088 |
| Heavy Atoms | 16 |
| Complexity | 264.0 |
Chemical Identifiers
| CAS Number | 6028-89-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C(=O)C=CC2=CC=CS2 |
| InChIKey | OUDDTWPBSXBJOY-UHFFFAOYSA-N |
Product Overview
1-(4-Methylphenyl)-3-(2-thienyl)-2-propen-1-one (CAS 6028-89-3), with molecular formula C14H12OS and molecular weight 228.06088 g/mol. IUPAC: 1-(4-methylphenyl)-3-thiophen-2-ylprop-2-en-1-one.
1-(4-Methylphenyl)-3-(2-thienyl)-2-propen-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »