ss-Hydroxyprogesteron
(8S,9S,10R,13S,14S,17S)-17-acetyl-2-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
Also Known As: ss-Hydroxyprogesteron|2-Hydroxy-4-pregnene-3,20-dione|2-Hydroxypregn-4-ene-3,20-dione|2alpha-Hydroxy-4-pregnene-3,20-dione|Pregn-4-ene-3,20-dione,2-hydroxy-, (2a)-|(8S,9S,10R,13S,14S,17S)-17-acetyl-2-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
| Molecular Formula | C21H30O3 |
|---|---|
| Molecular Weight | 330.21948 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 54.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 330.21948 |
| Monoisotopic Mass | 330.21948 |
| Heavy Atoms | 24 |
| Complexity | 621.0 |
Chemical Identifiers
| CAS Number | 604-28-4 |
|---|---|
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)C(C[C@]34C)O)C |
| InChIKey | BOZZHCVRWNSXMR-JFXKSSBPSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
ss-Hydroxyprogesteron (CAS 604-28-4), with molecular formula C21H30O3 and molecular weight 330.21948 g/mol. IUPAC: (8S,9S,10R,13S,14S,17S)-17-acetyl-2-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.