Hexaphenylisomelamine
2-N,4-N,6-N,1,3,5-hexakis-phenyl-1,3,5-triazinane-2,4,6-triimine
Also Known As: Hexaphenylisomelamine|(tert-Butyldioxy)methanol|Methanol, (tert-butyldioxy)-|BAS 00024817|2-N,4-N,6-N,1,3,5-hexakis-phenyl-1,3,5-triazinane-2,4,6-triimine|N~2~,N~4~,N~6~,1,3,5-Hexaphenyl-1,3,5-triazinane-2,4,6-triimine|(2E,4E,6E)-N1,2,N3,4,N5,6-hexaphenyl-1,3,5-triazinane-2,4,6-triimine|(2Z,4Z,6Z)-N~2~,N~4~,N~6~,1,3,5-Hexaphenyl-1,3,5-triazinane-2,4,6-triimine|N-[1,3,5-triphenyl-4,6-bis(phenylimino)-1,3,5-triazinan-2-ylidene]aniline
| Molecular Formula | C39H30N6 |
|---|---|
| Molecular Weight | 582.2532 g/mol |
| LogP | 9.6 |
| Topological Polar Surface Area | 46.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 582.2532 |
| Monoisotopic Mass | 582.2532 |
| Heavy Atoms | 45 |
| Complexity | 846.0 |
Chemical Identifiers
| CAS Number | 604-45-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)N=C2N(C(=NC3=CC=CC=C3)N(C(=NC4=CC=CC=C4)N2C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 |
| InChIKey | MBZKVOZDQXHTIK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Hexaphenylisomelamine (CAS 604-45-5), with molecular formula C39H30N6 and molecular weight 582.2532 g/mol. IUPAC: 2-N,4-N,6-N,1,3,5-hexakis-phenyl-1,3,5-triazinane-2,4,6-triimine.