Methyl 3,5-dimethoxy-4-methylbenzoate
methyl 3,5-dimethoxy-4-methylbenzoate
Also Known As: methyl 3,5-dimethoxy-4-methylbenzoate|starbld0016642|Methyl 3,5-dimethoxy-p-toluate|KS-00003SIZ|Methyl 4-methyl-3,5-dimethoxybenzoate|methyl 3,5-dimethoxy-4-methyl-benzoate|METHYL-3,5-DIMETHOXY-P-TOLUATE|3,5-Dimethoxy-4-methylbenzoic acid methyl ester|BB 0246913|METHYL3,5-DIMETHOXY-4-METHYLBENZOATE|J2.071.773D|3,5-DIMETHOXY-4-METHYL-BENZOIC ACID METHYL ESTER|3,5-Dimethoxy-4-methyl-benzoesaeure-methylester|3,5-Dimethoxy-4-methyl-benzoic acid methyl ester|5-chloro-2-(methylthio)pyrimidine-4-carboxylicacid
| Molecular Formula | C11H14O4 |
|---|---|
| Molecular Weight | 210.0892 g/mol |
| LogP | 1.79882 |
| Topological Polar Surface Area | 44.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 210.0892 |
| Monoisotopic Mass | 210.0892 |
| Heavy Atoms | 15 |
| Complexity | 345.84583 |
Chemical Identifiers
| CAS Number | 60441-79-4 |
|---|---|
| SMILES | CC1=C(C=C(C=C1OC)C(=O)OC)OC |
Product Overview
Methyl 3,5-dimethoxy-4-methylbenzoate (CAS 60441-79-4), with molecular formula C11H14O4 and molecular weight 210.0892 g/mol. IUPAC: methyl 3,5-dimethoxy-4-methylbenzoate.
Methyl 3,5-dimethoxy-4-methylbenzoate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »