![(2E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide structure](/static/products/6057/60573-40-2.webp)
(2E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide
(E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide
Also Known As: BAS 00321437|HS-5162|NCGC00331714-01|(2E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide|N-[4-(Dimethylamino)phenyl]benzeneacrylamide|J1.750.769I|trans-N-(4-Dimethylaminophenyl)-3-phenylpropenamide|AB00079305-01|AB00079305-03|N-(4-Dimethylamino-phenyl)-3-phenyl-acrylamide|(2Z)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide|N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide|(E)-N-(4-dimethylaminophenyl)-3-phenylprop-2-enamide
| Molecular Formula | C17H18N2O |
|---|---|
| Molecular Weight | 266.1419 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 32.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 266.1419 |
| Monoisotopic Mass | 266.1419 |
| Heavy Atoms | 20 |
| Complexity | 324.0 |
Chemical Identifiers
| CAS Number | 60573-40-2 |
|---|---|
| SMILES | CN(C)C1=CC=C(C=C1)NC(=O)/C=C/C2=CC=CC=C2 |
| InChIKey | VEFZPKIWMRETSQ-MDWZMJQESA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(2E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide (CAS 60573-40-2), with molecular formula C17H18N2O and molecular weight 266.1419 g/mol. IUPAC: (E)-N-[4-(dimethylamino)phenyl]-3-phenylprop-2-enamide.