Tetraethyl hexane-1,1,6,6-tetracarboxylate
tetraethyl hexane-1,1,6,6-tetracarboxylate
Also Known As: tetraethyl hexane-1,1,6,6-tetracarboxylate|tetraethylhexane-1,1,6,6-tetracarboxylate|2,7-Bis-ethoxycarbonyloctanedioic acid diethylester|J1.172.720D|2,7-Bis-ethoxycarbonyl-octanedioic acid diethyl ester|2,7-Bis-ethoxycarbonyloctanedioicaciddiethylester|1,1,6,6-Hexanetetracarboxylic acid tetraethyl ester|2,7-bis-ethoxycarbonyloctanedioic acid diethyl ester|1,1,6,6-Hexanetetrakis(carboxylic acid ethyl) ester|1,1,6,6-tetraethyl hexane-1,1,6,6-tetracarboxylate|hexane-1,1,6,6-tetracarboxylic acid tetraethyl ester|Hexane-1,1,6,6-tetrakis(carboxylic acid ethyl) ester|1,6,6-HEXANETETRACARBOXYLIC ACID, TETRAETHYL ESTER
| Molecular Formula | C18H30O8 |
|---|---|
| Molecular Weight | 374.19406 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 105.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Exact Mass | 374.19406 |
| Monoisotopic Mass | 374.19406 |
| Heavy Atoms | 26 |
| Complexity | 382.0 |
Chemical Identifiers
| CAS Number | 60784-52-3 |
|---|---|
| SMILES | CCOC(=O)C(CCCCC(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChIKey | NABJDVPVORXWSY-UHFFFAOYSA-N |
Product Overview
Tetraethyl hexane-1,1,6,6-tetracarboxylate (CAS 60784-52-3), with molecular formula C18H30O8 and molecular weight 374.19406 g/mol. IUPAC: tetraethyl hexane-1,1,6,6-tetracarboxylate.