1-(Butan-2-yl)-2-methoxy-3,5-dinitrobenzene
1-butan-2-yl-2-methoxy-3,5-dinitrobenzene
Also Known As: Dinoseb methyl ether|Dinoseb-methyl ether|DNBPME|Dinoseb, methyl ether|Dinoseb methyl ester|Anisole, 2-sec-butyl-4,6-dinitro-|DINOSEBMETHYLETHER|Dinoseb methyl ether solution|2-sec-Butyl-4,6-dinitroanisole|1-butan-2-yl-2-methoxy-3,5-dinitrobenzene|1-(butan-2-yl)-2-methoxy-3,5-dinitrobenzene|2,4-Dinitro-6-sec-butylphenol methyl ether|1-(sec-butyl)-2-methoxy-3,5-dinitrobenzene|2,4-Dinitro-6-sec-butylphenyl(methyl) ether|2-Sec-butyl-4,6-dinitrophenyl methyl ether #|Phenol, 2-(1-methylpropyl)-4,6-dinitro-, methylated|Phenol, 2-(1-methylpropyl), 4,6-dinitro, methyl ether|621-367-9
| Molecular Formula | C11H14N2O5 |
|---|---|
| Molecular Weight | 254.09027 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 101.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 254.09027 |
| Monoisotopic Mass | 254.09027 |
| Heavy Atoms | 18 |
| Complexity | 312.0 |
Chemical Identifiers
| CAS Number | 6099-79-2 |
|---|---|
| SMILES | CCC(C)C1=C(C(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-])OC |
| InChIKey | UVYHORVGKZXEMP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-(Butan-2-yl)-2-methoxy-3,5-dinitrobenzene (CAS 6099-79-2), with molecular formula C11H14N2O5 and molecular weight 254.09027 g/mol. IUPAC: 1-butan-2-yl-2-methoxy-3,5-dinitrobenzene.