2-Bromo-4-tert-butyl-1-methylbenzene
2-bromo-4-tert-butyl-1-methylbenzene
Also Known As: 2-bromo-4-tert-butyl-1-methylbenzene|2-Bromo-4-(tert-butyl)-1-methylbenzene|2-BROMO-4-TERT-BUTYL-1-METHYL-BENZENE|2-Bromo-4-tert-butyltoluene|2-bromo-1-methyl-4-tert-butyl-benzene|C(C)(C)(C)c1ccc(C)c(Br)c1|1607AJ|XH1052|1-Bromo-2-methyl-5-tert-butylbenzene|1-Methyl-2-bromo-4-tert-butylbenzene|4-(tert-butyl)-2-bromo-1-methylbenzene|Benzene, 2-bromo-4-(1,1-dimethylethyl)-1-methyl-|J1.508.592D|2,2,3,4,4,5,6,6-OCTACHLOROBIPHENYL|BENZENE,2-BROMO-4-(1,1-DIMETHYLETHYL)-1-METHYL-|660-431-0
| Molecular Formula | C11H15Br |
|---|---|
| Molecular Weight | 226.0357 g/mol |
| LogP | 4.6 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 1 |
| Exact Mass | 226.0357 |
| Monoisotopic Mass | 226.0357 |
| Heavy Atoms | 12 |
| Complexity | 146.0 |
Chemical Identifiers
| CAS Number | 61024-94-0 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)C(C)(C)C)Br |
| InChIKey | VEIYGWKHCOGECS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Bromo-4-tert-butyl-1-methylbenzene (CAS 61024-94-0), with molecular formula C11H15Br and molecular weight 226.0357 g/mol. IUPAC: 2-bromo-4-tert-butyl-1-methylbenzene.
2-Bromo-4-tert-butyl-1-methylbenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »