Schisandrin B
TL;DR: Schisandrin B (CAS 61281-37-6) is a chemical compound with molecular formula C23H28O6 and molecular weight 400.1886 g/mol, supplied by CoreyChem (Career Henan Chemical Co., Ltd.) with ISO-certified quality and global shipping.
3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene
Also Known As: Schisandrin B, Schizandrin B, gomisin N, Gamma-schizandrin, Isokadsuranin
Technical Specifications
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.1886 g/mol |
| XLogP | 5.1 |
| Topological Polar Surface Area (TPSA) | 55.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 400.1886 Da |
| Heavy Atoms | 29 |
| Complexity | 543.0 |
| SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)OC)OC)OCO3 |
| InChIKey | RTZKSTLPRTWFEV-UHFFFAOYSA-N |
Chemical Property Profile of Schisandrin B
Property Insights of Schisandrin B
The XLogP value of 5.1 indicates that Schisandrin B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 55.4 Ų, Schisandrin B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Schisandrin B has 0 hydrogen bond donor(s) and 6 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
What is the CAS number of Schisandrin B?
The CAS number of Schisandrin B is 61281-37-6.
What is the molecular formula of Schisandrin B?
The molecular formula of Schisandrin B is C23H28O6.
What is the molecular weight of Schisandrin B?
The molecular weight of Schisandrin B is 400.1886 g/mol.
Where can I buy Schisandrin B?
You can request a quote for Schisandrin B directly from CoreyChem. Contact us or email [email protected] for pricing and availability.
Does CoreyChem offer custom synthesis for Schisandrin B?
Yes, CoreyChem provides custom synthesis services for Schisandrin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.