2-((5-(Benzylthio)-1,3,4-thiadiazol-2-YL)thio)-1-(4-fluorophenyl)ethanone
2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)ethanone
Also Known As: 2-((5-(BENZYLTHIO)-1,3,4-THIADIAZOL-2-YL)THIO)-1-(4-FLUOROPHENYL)ETHANONE|1-(4-fluorophenyl)-2-[5-(phenylmethylthio)(1,3,4-thiadiazol-2-ylthio)]ethan-1- one|2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)ethanone|2-{[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl}-1-(4-fluorophenyl)ethan-1-one|2-{[5-(benzylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl}-1-(4-fluorophenyl)ethanone
| Molecular Formula | C17H13FN2OS3 |
|---|---|
| Molecular Weight | 376.0174 g/mol |
| LogP | 4.9445 |
| Topological Polar Surface Area | 42.85 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 376.0174 |
| Monoisotopic Mass | 376.0174 |
| Heavy Atoms | 24 |
| Complexity | 806.21765 |
Chemical Identifiers
| CAS Number | 613227-63-7 |
|---|---|
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(S2)SCC(=O)C3=CC=C(C=C3)F |
Product Overview
2-((5-(Benzylthio)-1,3,4-thiadiazol-2-YL)thio)-1-(4-fluorophenyl)ethanone (CAS 613227-63-7), with molecular formula C17H13FN2OS3 and molecular weight 376.0174 g/mol. IUPAC: 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)ethanone.