AC1OBMQI
3-(3-methoxyphenyl)-4-[(E)-(4-phenylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione
Also Known As: 3-(3-methoxyphenyl)-4-[(E)-(4-phenylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione|4-[(1E)-2-(4-phenylphenyl)-1-azavinyl]-5-(3-methoxyphenyl)-1,2,4-triazole-3-th iol|(E)-4-(([1,1'-biphenyl]-4-ylmethylene)amino)-5-(3-methoxyphenyl)-4H-1,2,4-triazole-3-thiol|4-{[(E)-[1,1'-BIPHENYL]-4-YLMETHYLIDENE]AMINO}-5-(3-METHOXYPHENYL)-4H-1,2,4-TRIAZOL-3-YL HYDROSULFIDE|4-{[(E)-biphenyl-4-ylmethylidene]amino}-5-(3-methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
| Molecular Formula | C22H18N4OS |
|---|---|
| Molecular Weight | 386.12012 g/mol |
| LogP | 5.16549 |
| Topological Polar Surface Area | 55.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 386.12012 |
| Monoisotopic Mass | 386.12012 |
| Heavy Atoms | 28 |
| Complexity | 1161.1283 |
Chemical Identifiers
| CAS Number | 613249-35-7 |
|---|---|
| SMILES | COC1=CC=CC(=C1)C2=NNC(=S)N2/N=C/C3=CC=C(C=C3)C4=CC=CC=C4 |
Product Overview
AC1OBMQI (CAS 613249-35-7), with molecular formula C22H18N4OS and molecular weight 386.12012 g/mol. IUPAC: 3-(3-methoxyphenyl)-4-[(E)-(4-phenylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.