3-Fluoro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol
3-fluoro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol
Also Known As: 2-Fluoroisoproterenol|3-fluoro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol|3H-Pyrrolizine-2-carboxylic acid,ethyl ester|1,2-Benzenediol, 3-fluoro-4-[1-hydroxy-2-[(1-methylethyl)amino]ethyl]-|3-Fluoro-4-[1-hydroxy-2-(isopropylamino)ethyl]-1,2-benzenediol|3-fluoro-4-{1-hydroxy-2-[(propan-2-yl)amino]ethyl}benzene-1,2-diol|Benzeneethanamine, 2-fluoro-.beta.,3,4-trihydroxy-N-isopropyl-|Benzeneethanamine, 2-fluoro-beta,3,4-trihydroxy-N-isopropyl-|3-Fluoro-4-[1-hydroxy-2-(isopropylamino)ethyl]-1,2-benzenediol #
| Molecular Formula | C11H16FNO3 |
|---|---|
| Molecular Weight | 229.11142 g/mol |
| LogP | 0.8 |
| Topological Polar Surface Area | 72.7 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 229.11142 |
| Monoisotopic Mass | 229.11142 |
| Heavy Atoms | 16 |
| Complexity | 215.0 |
Chemical Identifiers
| CAS Number | 61338-98-5 |
|---|---|
| SMILES | CC(C)NCC(C1=C(C(=C(C=C1)O)O)F)O |
| InChIKey | KEYFTYUBFSDBRW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-Fluoro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol (CAS 61338-98-5), with molecular formula C11H16FNO3 and molecular weight 229.11142 g/mol. IUPAC: 3-fluoro-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol.