4-Aminobenzoic acid;10-(2-pyrrolidin-1-ylethyl)phenothiazine
4-aminobenzoic acid;10-(2-pyrrolidin-1-ylethyl)phenothiazine
Also Known As: 4-aminobenzoic acid,10-(2-pyrrolidin-1-ylethyl)phenothiazine|4-aminobenzoic acid- 10-[2-(pyrrolidin-1-yl)ethyl]-10h-phenothiazine(1:1)|4-aminobenzoic acid; 10-(2-pyrrolidin-1-ylethyl)phenothiazine|4-Aminobenzoic acid;10-(2-pyrrolidin-1-ylethyl)phenothiazine|4-aminobenzoic acid-10-[2-(pyrrolidin-1-yl)ethyl]-10h-phenothiazine(1:1)|4-AMINOBENZOIC ACID, COMPOUND WITH 10-[2-(1-PYRROLIDINYL)ETHYL]PHENOTHIAZINE (1:1)|4-Aminobenzoic acid--10-[2-(pyrrolidin-1-yl)ethyl]-10H-phenothiazine (1/1)
| Molecular Formula | C25H27N3O2S |
|---|---|
| Molecular Weight | 433.1824 g/mol |
| LogP | 5.3521 |
| Topological Polar Surface Area | 95.1 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 433.1824 |
| Monoisotopic Mass | 433.1824 |
| Heavy Atoms | 31 |
| Complexity | 448.0 |
Chemical Identifiers
| CAS Number | 61356-48-7 |
|---|---|
| SMILES | C1CCN(C1)CCN2C3=CC=CC=C3SC4=CC=CC=C42.C1=CC(=CC=C1C(=O)O)N |
| InChIKey | JFTYTLNPJIPSCN-UHFFFAOYSA-N |
Product Overview
4-Aminobenzoic acid;10-(2-pyrrolidin-1-ylethyl)phenothiazine (CAS 61356-48-7), with molecular formula C25H27N3O2S and molecular weight 433.1824 g/mol. IUPAC: 4-aminobenzoic acid;10-(2-pyrrolidin-1-ylethyl)phenothiazine.