5-bromo-7-chloro-2,3-dihydro-1H-indole-2,3-dione
5-bromo-7-chloro-1H-indole-2,3-dione
Also Known As: 5-bromo-7-chloro-1H-indole-2,3-dione|5-bromo-7-chloroindoline-2,3-dione|null|5-bromo-7-chloro-2,3-dihydro-1H-indole-2,3-dione|AC6472|5-bromo-7-chloro-indoline-2,3-dione|1H-Indole-2,3-dione, 5-bromo-7-chloro-|3-methoxy-4-(2-phenoxyethoxy)benzaldehyde|J3.547.351C|Y-0719|5-bromo-7-chloro-1H-indole-2,3-dione, 613656-97-6, AC1NFIR1, CTK5B3111, MolPort-000-183-617, BB_SC-8623, STK942727, ZINC08376417, 5-bromo-7-chloroindoline-2,3-dione, AKOS000140954, AG-G-23522, MCULE-4729981560, AB1007447, KB-245280, EN300-80727|817-474-7
| Molecular Formula | C8H3BrClNO2 |
|---|---|
| Molecular Weight | 258.90356 g/mol |
| LogP | 2.2373 |
| Topological Polar Surface Area | 46.17 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 258.90356 |
| Monoisotopic Mass | 258.90356 |
| Heavy Atoms | 13 |
| Complexity | 430.39737 |
Chemical Identifiers
| CAS Number | 613656-97-6 |
|---|---|
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)Br |
Product Overview
5-bromo-7-chloro-2,3-dihydro-1H-indole-2,3-dione (CAS 613656-97-6), with molecular formula C8H3BrClNO2 and molecular weight 258.90356 g/mol. IUPAC: 5-bromo-7-chloro-1H-indole-2,3-dione.