9-(4-Methoxy-2,5-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid
9-(4-methoxy-2,5-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid
Also Known As: 2,4,6,8-Nonatetraenoic acid, 9-(4-methoxy-2,5-dimethylphenyl)-3,7-dimethyl-, (all-E)-|9-(4-Methoxy-2,5-dimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoic acid (all-E)-|(2Z,4Z,6Z,8Z)-9-(4-methoxy-2,5-dimethyl-phenyl)-3,7-dimethyl-nona-2,4,6,8-tetraenoic acid
| Molecular Formula | C20H24O3 |
|---|---|
| Molecular Weight | 312.17255 g/mol |
| LogP | 5.8 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 312.17255 |
| Monoisotopic Mass | 312.17255 |
| Heavy Atoms | 23 |
| Complexity | 511.0 |
Chemical Identifiers
| CAS Number | 61435-52-7 |
|---|---|
| SMILES | CC1=CC(=C(C=C1OC)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| InChIKey | LFDCZFDLUDUTQH-UHFFFAOYSA-N |
Product Overview
9-(4-Methoxy-2,5-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (CAS 61435-52-7), with molecular formula C20H24O3 and molecular weight 312.17255 g/mol. IUPAC: 9-(4-methoxy-2,5-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
9-(4-Methoxy-2,5-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »