RefChem:595869
ethyl 6-(3-fluorophenyl)-8-methyl-4-oxo-3,6-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
Also Known As: ethyl 6-(3-fluorophenyl)-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate|BAS 06261518|AF-399/41899618|ethyl 6-(3-fluorophenyl)-8-methyl-4-oxo-3,6-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate|645-787-7|ethyl 6-(3-fluorophenyl)-8-methyl-4-oxo-2H,3H,4H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate|ETHYL 6-(3-FLUOROPHENYL)-8-METHYL-4-OXO-3,4-DIHYDRO-2H,6H-PYRIMIDO(2,1-B)(1,3)THIAZINE-7-CARBOXYLATE
| Molecular Formula | C17H17FN2O3S |
|---|---|
| Molecular Weight | 348.0944 g/mol |
| LogP | 3.039 |
| Topological Polar Surface Area | 58.97 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 348.0944 |
| Monoisotopic Mass | 348.0944 |
| Heavy Atoms | 24 |
| Complexity | 759.95746 |
Chemical Identifiers
| CAS Number | 618075-73-3 |
|---|---|
| SMILES | CCOC(=O)C1=C(N=C2N(C1C3=CC(=CC=C3)F)C(=O)CCS2)C |
Product Overview
RefChem:595869 (CAS 618075-73-3), with molecular formula C17H17FN2O3S and molecular weight 348.0944 g/mol. IUPAC: ethyl 6-(3-fluorophenyl)-8-methyl-4-oxo-3,6-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate.