2,8-Diazaspiro(5.5)undecane-1,3,7,9-tetrone
2,8-diazaspiro[5.5]undecane-1,3,7,9-tetrone
Also Known As: 2,8-Diazaspiro[5.5]undecane-1,3,7,9-tetrone|4,6-Dimethyl-heptan-2-on|2,8-Diazaspiro(5.5)undecane-1,3,7,9-tetrone|2,8-diazaspiro[5.5]undecane-1,3,7,9-tetraone|BAS 02785746|NCI60_017657|2,8-diazaspiro[5.5]undecan-1,3,7,9-tetron|2,8-Diaza-spiro[5.5]undecane-1,3,7,9-tetraone|4,10-diazaspiro[5.5]undecane-3,5,9,11-tetrone|AK-564/15482011|2,8-Diazaspiro[5.5]undecane-1,3,7,9-tetrone #
| Molecular Formula | C9H10N2O4 |
|---|---|
| Molecular Weight | 210.06406 g/mol |
| LogP | -1.5 |
| Topological Polar Surface Area | 92.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 210.06406 |
| Monoisotopic Mass | 210.06406 |
| Heavy Atoms | 15 |
| Complexity | 338.0 |
Chemical Identifiers
| CAS Number | 6185-83-7 |
|---|---|
| SMILES | C1CC2(CCC(=O)NC2=O)C(=O)NC1=O |
| InChIKey | VLXWUMRXYIGSMF-UHFFFAOYSA-N |
Product Overview
2,8-Diazaspiro(5.5)undecane-1,3,7,9-tetrone (CAS 6185-83-7), with molecular formula C9H10N2O4 and molecular weight 210.06406 g/mol. IUPAC: 2,8-diazaspiro[5.5]undecane-1,3,7,9-tetrone.
2,8-Diazaspiro(5.5)undecane-1,3,7,9-tetrone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »