Ethyl 4'-chloro-5-hydroxy(1,1'-biphenyl)-3-acetate
ethyl 2-[3-(4-chlorophenyl)-5-hydroxyphenyl]acetate
Also Known As: Ethyl 4'-chloro-5-hydroxy-3-biphenylacetate|(1,1'-Biphenyl)-3-acetic acid, 4'-chloro-5-hydroxy-, ethyl ester|ethyl 2-[3-(4-chlorophenyl)-5-hydroxyphenyl]acetate|4'-Chloro-5-hydroxy- -3-aceticacidethylester|Ethyl 4'-chloro-5-hydroxy-(1,1'-biphenyl)-3-acetate|4'-Chloro-5-hydroxy-(1,1'-biphenyl)-3-acetic acid ethyl ester|Ethyl 4'-chloro-5-hydroxy(1,1'-biphenyl)-3-acetate|Ethyl (4'-chloro-5-hydroxy[1,1'-biphenyl]-3-yl)acetate|[1,1'-Biphenyl]-3-aceticacid, 4'-chloro-5-hydroxy-, ethyl ester
| Molecular Formula | C16H15ClO3 |
|---|---|
| Molecular Weight | 290.07098 g/mol |
| LogP | 3.8182 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 290.07098 |
| Monoisotopic Mass | 290.07098 |
| Heavy Atoms | 20 |
| Complexity | 605.6191 |
Chemical Identifiers
| CAS Number | 61888-75-3 |
|---|---|
| SMILES | CCOC(=O)CC1=CC(=CC(=C1)O)C2=CC=C(C=C2)Cl |
Product Overview
Ethyl 4'-chloro-5-hydroxy(1,1'-biphenyl)-3-acetate (CAS 61888-75-3), with molecular formula C16H15ClO3 and molecular weight 290.07098 g/mol. IUPAC: ethyl 2-[3-(4-chlorophenyl)-5-hydroxyphenyl]acetate.