(R)-Lipoate
5-[(3R)-dithiolan-3-yl]pentanoate
Also Known As: lipoic acid|(R)-lipoate|D-thioctate|(R)-lipoic acid|6,8-thioctate|D-Thioctic acid|R-Lipoic acid|alpha-liponic acid|d-alpha-lipoic acid|6,8-Thioctic acid|(R)-(+)-Lipoate|(R)-alpha-Lipoic acid|R-(+)-alpha-Lipoic acid|(r)-(+)-alpha-lipoic acid|5-[(3R)-dithiolan-3-yl]pentanoate|5-(1,2-dithiolan-3-yl)-pentanoate|5-[(3R)-1,2-dithiolan-3-yl]pentanoate|5-[(3R)-3-dithiolanyl]pentanoate|(R)-ALPHA-LIPOIC ACID 100G|(R)-1,2-Dithiolane-3-pentanoic acid|(R)-(+)-1,2-Dithiolane-3-pentanoic acid|5-((3R)-1,2-dithiolan-3-yl)pentanoate|5-[(3R)-1,2-dithiolan-3-yl]pentanoicacid|5-[(3R)-1,2-dithiolan-3-yl]pentanoic acid|B0084-359920|(R)-( )-1,2-Dithiolane-3-pentanoic acid, 98% - 25G 25g|(R)-(+)-a-Lipoic acid =98.0% (by HPLC, titration analysis)
| Molecular Formula | C8H13O2S2- |
|---|---|
| Molecular Weight | 205.03569 g/mol |
| LogP | 1.4504 |
| Topological Polar Surface Area | 40.13 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 205.03569 |
| Monoisotopic Mass | 205.03569 |
| Heavy Atoms | 12 |
| Complexity | 143.99329 |
Chemical Identifiers
| CAS Number | 62-46-4 |
|---|---|
| SMILES | C1CSS[C@@H]1CCCCC(=O)[O-] |
Product Overview
(R)-Lipoate (CAS 62-46-4), with molecular formula C8H13O2S2- and molecular weight 205.03569 g/mol. IUPAC: 5-[(3R)-dithiolan-3-yl]pentanoate.