1,3-Bis(3-methylphenyl)urea
1,3-bis(3-methylphenyl)urea
Also Known As: 1,3-bis(3-methylphenyl)urea|mBrMePU|mMePU|N,N'-(Di-m-methylphenyl)urea|1,3-Di-m-tolylurea|1,3-bis(tolyl) urea|1,3-di-m-tolyl-urea|Maybridge4_003486|1,3-di-m-tolylcarbamide|N,N'-di(3-tolyl)urea|Carbanilide, 3,3'-dimethyl-|N,N'-Bis(3-methylphenyl)urea|1,3-Di(3-methylphenyl)urea|Urea, 1,3-di(3-tolyl)-|Urea, N,N'-bis(3-methylphenyl)-|N,N'-Bis(3-methylphenyl)urea #|N,N'-di-(3-methyl phenyl)-urea|1-(m-bromophenyl)-3-(m-tolyl) urea|1-(m-chlorophenyl)-3-(m-tolyl) urea|NCGC00175793-01
| Molecular Formula | C15H16N2O |
|---|---|
| Molecular Weight | 240.12627 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 41.1 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 240.12627 |
| Monoisotopic Mass | 240.12627 |
| Heavy Atoms | 18 |
| Complexity | 254.0 |
Chemical Identifiers
| CAS Number | 620-50-8 |
|---|---|
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=CC(=C2)C |
| InChIKey | UPUMJVLEADOLKF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,3-Bis(3-methylphenyl)urea (CAS 620-50-8), with molecular formula C15H16N2O and molecular weight 240.12627 g/mol. IUPAC: 1,3-bis(3-methylphenyl)urea.