1-(4'-Isobutylphenyl)ethyl chloride
1-(1-chloroethyl)-4-(2-methylpropyl)benzene
Also Known As: 1-(1-Chloroethyl)-4-isobutylbenzene|1-(4'-isobutylphenyl)ethyl chloride|EINECS 263-391-9|1-(1-chloroethyl)-4-(2-methylpropyl)benzene|1-(4-isobutylphenyl)ethyl chloride|1-chloro-1-(4-isobutylphenyl)ethane|1-Isobutyl-4-(1-chloroethyl)benzene|4-Isobutyl-alpha-methylbenzyl chloride|alpha-Methyl-4-isobutylbenzyl chloride|Benzene, 1-(1-chloroethyl)-4-(2-methylpropyl)-|4-(2-Methylpropyl)-1-(1-chloroethyl)benzene|Benzene,1-(1-chloroethyl)-4-(2-methylpropyl)-|1-(4 inverted exclamation marka-Isobutylphenyl)ethyl chloride|263-391-9
| Molecular Formula | C12H17Cl |
|---|---|
| Molecular Weight | 196.10188 g/mol |
| LogP | 4.1849 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 196.10188 |
| Monoisotopic Mass | 196.10188 |
| Heavy Atoms | 13 |
| Complexity | 246.33191 |
Chemical Identifiers
| CAS Number | 62049-65-4 |
|---|---|
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)Cl |
Product Overview
1-(4'-Isobutylphenyl)ethyl chloride (CAS 62049-65-4), with molecular formula C12H17Cl and molecular weight 196.10188 g/mol. IUPAC: 1-(1-chloroethyl)-4-(2-methylpropyl)benzene.